C20H23ClN2O5 — CID 24837505
N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;perchloric acid (PubChem CID 24837505) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;perchloric acid.
| Compound Name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;perchloric acid |
|---|---|
| PubChem CID | 24837505 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;perchloric acid |
| SMILES | CN(C)CCCON=c1c2ccccc2ccc2ccccc12.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C20H22N2O.ClHO4/c1-22(2)14-7-15-23-21-20-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)20;2-1(3,4)5/h3-6,8-13H,7,14-15H2,1-2H3;(H,2,3,4,5) |
| InChIKey | FIJJINNQLBUDEU-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|