C17H22ClNO5 — CID 71349931
2-benzhydryloxy-N,N-dimethylethanamine;perchloric acid (PubChem CID 71349931) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-benzhydryloxy-N,N-dimethylethanamine;perchloric acid.
| Compound Name | 2-benzhydryloxy-N,N-dimethylethanamine;perchloric acid |
|---|---|
| PubChem CID | 71349931 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;perchloric acid |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C17H21NO.ClHO4/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;2-1(3,4)5/h3-12,17H,13-14H2,1-2H3;(H,2,3,4,5) |
| InChIKey | YSSHEKJUVJSCRW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |