About Diphenhydramine Hydrochloride
Diphenhydramine Hydrochloride (PubChem CID 8980) has the molecular formula C17H22ClNO
and a molecular weight of 291.80 g/mol. Its IUPAC name is 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | Diphenhydramine Hydrochloride |
| PubChem CID | 8980 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H |
| InChIKey | PCHPORCSPXIHLZ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 12.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 211 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Diphenhydramine Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenhydramine Hydrochloride?
The IUPAC name of Diphenhydramine Hydrochloride (CID 8980) is 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for Diphenhydramine Hydrochloride?
The canonical SMILES for Diphenhydramine Hydrochloride is CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl.
What is the InChIKey of Diphenhydramine Hydrochloride?
The InChIKey is PCHPORCSPXIHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H.
What are the key properties of Diphenhydramine Hydrochloride?
Diphenhydramine Hydrochloride has a molecular weight of 291.80 g/mol, XLogP of not available, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenhydramine Hydrochloride is sourced from PubChem (CID 8980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).