About 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride
2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride (PubChem CID 8980) has the molecular formula C17H22ClNO
and a molecular weight of 291.82 g/mol. Its IUPAC name is 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 8980 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H |
| InChIKey | PCHPORCSPXIHLZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride (CID 8980) is 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride is CN(C)CCOC(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride?
The InChIKey is PCHPORCSPXIHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H.
What are the key properties of 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride?
2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride has a molecular weight of 291.82 g/mol, XLogP of 3.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 8980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).