About Orphenadrine Hydrochloride
Orphenadrine Hydrochloride (PubChem CID 9568) has the molecular formula C18H24ClNO
and a molecular weight of 305.80 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | Orphenadrine Hydrochloride |
| PubChem CID | 9568 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine;hydrochloride |
| SMILES | CC1=CC=CC=C1C(C2=CC=CC=C2)OCCN(C)C.Cl |
| InChI | InChI=1S/C18H23NO.ClH/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16;/h4-12,18H,13-14H2,1-3H3;1H |
| InChIKey | UQZKYYIKWZOKKD-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 12.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 260 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Orphenadrine Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Orphenadrine Hydrochloride?
The IUPAC name of Orphenadrine Hydrochloride (CID 9568) is N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine;hydrochloride.
What is the SMILES notation for Orphenadrine Hydrochloride?
The canonical SMILES for Orphenadrine Hydrochloride is CC1=CC=CC=C1C(C2=CC=CC=C2)OCCN(C)C.Cl.
What is the InChIKey of Orphenadrine Hydrochloride?
The InChIKey is UQZKYYIKWZOKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO.ClH/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16;/h4-12,18H,13-14H2,1-3H3;1H.
What are the key properties of Orphenadrine Hydrochloride?
Orphenadrine Hydrochloride has a molecular weight of 305.80 g/mol, XLogP of not available, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Orphenadrine Hydrochloride is sourced from PubChem (CID 9568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).