C16H22ClNO — CID 22666549
N,N-dimethyl-2-(2-naphthalen-1-ylethoxy)ethanamine;hydrochloride (PubChem CID 22666549) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-naphthalen-1-ylethoxy)ethanamine;hydrochloride.
| Compound Name | N,N-dimethyl-2-(2-naphthalen-1-ylethoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 22666549 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N,N-dimethyl-2-(2-naphthalen-1-ylethoxy)ethanamine;hydrochloride |
| SMILES | CN(C)CCOCCc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C16H21NO.ClH/c1-17(2)11-13-18-12-10-15-8-5-7-14-6-3-4-9-16(14)15;/h3-9H,10-13H2,1-2H3;1H |
| InChIKey | UNRVLHQKEGKBAZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|