C23H34N2O3 — CID 66933701
N-[2-(diethylamino)ethyl]-N-(2-hydroxyethyl)-3-(2-naphthalen-1-ylethoxy)propanamide (PubChem CID 66933701) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(2-hydroxyethyl)-3-(2-naphthalen-1-ylethoxy)propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(2-hydroxyethyl)-3-(2-naphthalen-1-ylethoxy)propanamide |
|---|---|
| PubChem CID | 66933701 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(2-hydroxyethyl)-3-(2-naphthalen-1-ylethoxy)propanamide |
| SMILES | CCN(CC)CCN(CCO)C(=O)CCOCCc1cccc2ccccc12 |
| InChI | InChI=1S/C23H34N2O3/c1-3-24(4-2)14-15-25(16-17-26)23(27)13-19-28-18-12-21-10-7-9-20-8-5-6-11-22(20)21/h5-11,26H,3-4,12-19H2,1-2H3 |
| InChIKey | UHEWDJQKVSOPCI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|