C19H29ClN2O3 — CID 59224576
3-[2-(3-chlorophenyl)ethoxy]-N-[2-(diethylamino)ethyl]-N-(2-oxoethyl)propanamide (PubChem CID 59224576) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethoxy]-N-[2-(diethylamino)ethyl]-N-(2-oxoethyl)propanamide.
| Compound Name | 3-[2-(3-chlorophenyl)ethoxy]-N-[2-(diethylamino)ethyl]-N-(2-oxoethyl)propanamide |
|---|---|
| PubChem CID | 59224576 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethoxy]-N-[2-(diethylamino)ethyl]-N-(2-oxoethyl)propanamide |
| SMILES | CCN(CC)CCN(CC=O)C(=O)CCOCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H29ClN2O3/c1-3-21(4-2)10-11-22(12-13-23)19(24)9-15-25-14-8-17-6-5-7-18(20)16-17/h5-7,13,16H,3-4,8-12,14-15H2,1-2H3 |
| InChIKey | ZQCLGAITVGLEKS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|