C23H27N3O6 — CID 18560646
1-(fluoren-9-ylideneamino)oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;oxalic acid (PubChem CID 18560646) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-(fluoren-9-ylideneamino)oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;oxalic acid.
| Compound Name | 1-(fluoren-9-ylideneamino)oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 18560646 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-(fluoren-9-ylideneamino)oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;oxalic acid |
| SMILES | CN1CCN(CC(O)CON=C2c3ccccc3-c3ccccc32)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H25N3O2.C2H2O4/c1-23-10-12-24(13-11-23)14-16(25)15-26-22-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21;3-1(4)2(5)6/h2-9,16,25H,10-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | INJZZJKSZFOFAX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|