C23H28N2O2 — CID 16896476
1-(3,5-dimethylpiperidin-1-yl)-3-(fluoren-9-ylideneamino)oxypropan-2-ol (PubChem CID 16896476) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-3-(fluoren-9-ylideneamino)oxypropan-2-ol.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-3-(fluoren-9-ylideneamino)oxypropan-2-ol |
|---|---|
| PubChem CID | 16896476 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-3-(fluoren-9-ylideneamino)oxypropan-2-ol |
| SMILES | CC1CC(C)CN(CC(O)CON=C2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C23H28N2O2/c1-16-11-17(2)13-25(12-16)14-18(26)15-27-24-23-21-9-5-3-7-19(21)20-8-4-6-10-22(20)23/h3-10,16-18,26H,11-15H2,1-2H3 |
| InChIKey | LSCGZJZKKAPTNP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|