C23H28N2O2 — CID 7730801
(2S)-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol (PubChem CID 7730801) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2S)-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol.
| Compound Name | (2S)-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol |
|---|---|
| PubChem CID | 7730801 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2S)-1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol |
| SMILES | C[C@@H]1CCC[C@H](C)N1C[C@H](O)CON=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H28N2O2/c1-16-8-7-9-17(2)25(16)14-18(26)15-27-24-23-21-12-5-3-10-19(21)20-11-4-6-13-22(20)23/h3-6,10-13,16-18,26H,7-9,14-15H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | IGMGKOIULCISEA-KSZLIROESA-N |
| XLogP | 4.06 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|