C18H28BrNO3 — CID 7424701
(2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol (PubChem CID 7424701) has the molecular formula C18H28BrNO3 and a molecular weight of 386.33 g/mol. Its IUPAC name is (2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7424701 |
| Molecular Formula | C18H28BrNO3 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (2S)-1-[2-(2-bromophenoxy)ethoxy]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
| SMILES | C[C@H]1C[C@H](C)CN(C[C@H](O)COCCOc2ccccc2Br)C1 |
| InChI | InChI=1S/C18H28BrNO3/c1-14-9-15(2)11-20(10-14)12-16(21)13-22-7-8-23-18-6-4-3-5-17(18)19/h3-6,14-16,21H,7-13H2,1-2H3/t14-,15-,16-/m0/s1 |
| InChIKey | VMUMPMNLXWFPPX-JYJNAYRXSA-N |
| XLogP | 3.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|