C15H25N3O7 — CID 21155023
2-(diethylaminomethyl)pyridin-3-ol;dimethylcarbamic acid;oxalic acid (PubChem CID 21155023) has the molecular formula C15H25N3O7 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-(diethylaminomethyl)pyridin-3-ol;dimethylcarbamic acid;oxalic acid.
| Compound Name | 2-(diethylaminomethyl)pyridin-3-ol;dimethylcarbamic acid;oxalic acid |
|---|---|
| PubChem CID | 21155023 |
| Molecular Formula | C15H25N3O7 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-(diethylaminomethyl)pyridin-3-ol;dimethylcarbamic acid;oxalic acid |
| SMILES | CCN(CC)Cc1ncccc1O.CN(C)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H16N2O.C3H7NO2.C2H2O4/c1-3-12(4-2)8-9-10(13)6-5-7-11-9;1-4(2)3(5)6;3-1(4)2(5)6/h5-7,13H,3-4,8H2,1-2H3;1-2H3,(H,5,6);(H,3,4)(H,5,6) |
| InChIKey | QDJCEOSRIYJLGA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|