C10H15N3O2 — CID 55209592
3-[ethyl(pyrimidin-2-ylmethyl)amino]propanoic acid (PubChem CID 55209592) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-[ethyl(pyrimidin-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[ethyl(pyrimidin-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 55209592 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-[ethyl(pyrimidin-2-ylmethyl)amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)Cc1ncccn1 |
| InChI | InChI=1S/C10H15N3O2/c1-2-13(7-4-10(14)15)8-9-11-5-3-6-12-9/h3,5-6H,2,4,7-8H2,1H3,(H,14,15) |
| InChIKey | MFUOVTZHZPVKBP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |