C13H20N2O4 — CID 103173485
3-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]propanoic acid (PubChem CID 103173485) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]propanoic acid.
| Compound Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 103173485 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)Cc1nccc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O4/c1-4-15(8-6-12(16)17)9-10-13(19-3)11(18-2)5-7-14-10/h5,7H,4,6,8-9H2,1-3H3,(H,16,17) |
| InChIKey | JVQVEZGBCSYUNC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |