C9H15N3O2 — CID 84758753
3-[ethyl(1H-imidazol-5-ylmethyl)amino]propanoic acid (PubChem CID 84758753) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-[ethyl(1H-imidazol-5-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[ethyl(1H-imidazol-5-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 84758753 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-[ethyl(1H-imidazol-5-ylmethyl)amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-12(4-3-9(13)14)6-8-5-10-7-11-8/h5,7H,2-4,6H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | SXKHBXBMVLNZEF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |