C10H20N4O — CID 68977310
N,N-diethylethanamine;1H-imidazole-5-carboxamide (PubChem CID 68977310) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N,N-diethylethanamine;1H-imidazole-5-carboxamide.
| Compound Name | N,N-diethylethanamine;1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 68977310 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N,N-diethylethanamine;1H-imidazole-5-carboxamide |
| SMILES | CCN(CC)CC.NC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C6H15N.C4H5N3O/c1-4-7(5-2)6-3;5-4(8)3-1-6-2-7-3/h4-6H2,1-3H3;1-2H,(H2,5,8)(H,6,7) |
| InChIKey | URYSLIJBEVMHRW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |