C9H17N3O2 — CID 115882703
2-[1H-imidazol-5-ylmethyl(2-methoxyethyl)amino]ethanol (PubChem CID 115882703) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[1H-imidazol-5-ylmethyl(2-methoxyethyl)amino]ethanol.
| Compound Name | 2-[1H-imidazol-5-ylmethyl(2-methoxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 115882703 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-[1H-imidazol-5-ylmethyl(2-methoxyethyl)amino]ethanol |
| SMILES | COCCN(CCO)Cc1cnc[nH]1 |
| InChI | InChI=1S/C9H17N3O2/c1-14-5-3-12(2-4-13)7-9-6-10-8-11-9/h6,8,13H,2-5,7H2,1H3,(H,10,11) |
| InChIKey | GAQFJLKYYAXFDD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |