C14H21FN4O3 — CID 89375448
(3E)-6-fluoro-N-(1H-imidazol-5-ylmethyl)-N-(2-methoxyethyl)-2-nitrohepta-1,3-dien-4-amine (PubChem CID 89375448) has the molecular formula C14H21FN4O3 and a molecular weight of 312.35 g/mol. Its IUPAC name is (3E)-6-fluoro-N-(1H-imidazol-5-ylmethyl)-N-(2-methoxyethyl)-2-nitrohepta-1,3-dien-4-amine.
| Compound Name | (3E)-6-fluoro-N-(1H-imidazol-5-ylmethyl)-N-(2-methoxyethyl)-2-nitrohepta-1,3-dien-4-amine |
|---|---|
| PubChem CID | 89375448 |
| Molecular Formula | C14H21FN4O3 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3E)-6-fluoro-N-(1H-imidazol-5-ylmethyl)-N-(2-methoxyethyl)-2-nitrohepta-1,3-dien-4-amine |
| SMILES | C=C(/C=C(\CC(C)F)N(CCOC)Cc1cnc[nH]1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H21FN4O3/c1-11(15)6-14(7-12(2)19(20)21)18(4-5-22-3)9-13-8-16-10-17-13/h7-8,10-11H,2,4-6,9H2,1,3H3,(H,16,17)/b14-7+ |
| InChIKey | ZABKBIBTMJRZCS-VGOFMYFVSA-N |
| XLogP | 2.28 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|