C18H25FN4O — CID 135102264
N-[2-(dimethylamino)ethyl]-4-(4-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)butanamide (PubChem CID 135102264) has the molecular formula C18H25FN4O and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(4-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)butanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(4-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 135102264 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(4-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)butanamide |
| SMILES | CN(C)CCN(Cc1cnc[nH]1)C(=O)CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN4O/c1-22(2)10-11-23(13-17-12-20-14-21-17)18(24)5-3-4-15-6-8-16(19)9-7-15/h6-9,12,14H,3-5,10-11,13H2,1-2H3,(H,20,21) |
| InChIKey | SXFZDYIVJYUFTN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |