C19H27FN4O5 — CID 154916583
N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid (PubChem CID 154916583) has the molecular formula C19H27FN4O5 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid |
|---|---|
| PubChem CID | 154916583 |
| Molecular Formula | C19H27FN4O5 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid |
| SMILES | CN(C)CCN(Cc1cnc[nH]1)C(=O)CCc1cccc(F)c1.O=CO.O=CO |
| InChI | InChI=1S/C17H23FN4O.2CH2O2/c1-21(2)8-9-22(12-16-11-19-13-20-16)17(23)7-6-14-4-3-5-15(18)10-14;2*2-1-3/h3-5,10-11,13H,6-9,12H2,1-2H3,(H,19,20);2*1H,(H,2,3) |
| InChIKey | GLWVAWKKJRJFIG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|