C15H18FNO — CID 78829539
3-(3-fluorophenyl)-N,N-bis(prop-2-enyl)propanamide (PubChem CID 78829539) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N,N-bis(prop-2-enyl)propanamide.
| Compound Name | 3-(3-fluorophenyl)-N,N-bis(prop-2-enyl)propanamide |
|---|---|
| PubChem CID | 78829539 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)CCc1cccc(F)c1 |
| InChI | InChI=1S/C15H18FNO/c1-3-10-17(11-4-2)15(18)9-8-13-6-5-7-14(16)12-13/h3-7,12H,1-2,8-11H2 |
| InChIKey | SGGRBTGQXUYIEF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|