C15H20FNO — CID 51983037
N-[(1R)-1-cyclopropylethyl]-3-(3-fluorophenyl)-N-methylpropanamide (PubChem CID 51983037) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[(1R)-1-cyclopropylethyl]-3-(3-fluorophenyl)-N-methylpropanamide.
| Compound Name | N-[(1R)-1-cyclopropylethyl]-3-(3-fluorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 51983037 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-[(1R)-1-cyclopropylethyl]-3-(3-fluorophenyl)-N-methylpropanamide |
| SMILES | C[C@H](C1CC1)N(C)C(=O)CCc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO/c1-11(13-7-8-13)17(2)15(18)9-6-12-4-3-5-14(16)10-12/h3-5,10-11,13H,6-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | FLFGOQLJMVNATK-LLVKDONJSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |