C17H24FNO — CID 86876241
N-(1,4-dimethylcyclohexyl)-3-(3-fluorophenyl)propanamide (PubChem CID 86876241) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is N-(1,4-dimethylcyclohexyl)-3-(3-fluorophenyl)propanamide.
| Compound Name | N-(1,4-dimethylcyclohexyl)-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 86876241 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(1,4-dimethylcyclohexyl)-3-(3-fluorophenyl)propanamide |
| SMILES | CC1CCC(C)(NC(=O)CCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H24FNO/c1-13-8-10-17(2,11-9-13)19-16(20)7-6-14-4-3-5-15(18)12-14/h3-5,12-13H,6-11H2,1-2H3,(H,19,20) |
| InChIKey | MQGZZUCEGUDCEZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |