C17H24BrNO3S — CID 52834535
2-[(3-bromophenyl)methylsulfonyl]-N-(1,4-dimethylcyclohexyl)acetamide (PubChem CID 52834535) has the molecular formula C17H24BrNO3S and a molecular weight of 402.35 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfonyl]-N-(1,4-dimethylcyclohexyl)acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfonyl]-N-(1,4-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 52834535 |
| Molecular Formula | C17H24BrNO3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfonyl]-N-(1,4-dimethylcyclohexyl)acetamide |
| SMILES | CC1CCC(C)(NC(=O)CS(=O)(=O)Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H24BrNO3S/c1-13-6-8-17(2,9-7-13)19-16(20)12-23(21,22)11-14-4-3-5-15(18)10-14/h3-5,10,13H,6-9,11-12H2,1-2H3,(H,19,20) |
| InChIKey | ZIINAWCDBOKPQI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |