C10H12FO2+ — CID 160822973
4-(3-fluorophenyl)butanoyloxidanium (PubChem CID 160822973) has the molecular formula C10H12FO2+ and a molecular weight of 183.20 g/mol. Its IUPAC name is 4-(3-fluorophenyl)butanoyloxidanium.
| Compound Name | 4-(3-fluorophenyl)butanoyloxidanium |
|---|---|
| PubChem CID | 160822973 |
| Molecular Formula | C10H12FO2+ |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-(3-fluorophenyl)butanoyloxidanium |
| SMILES | O=C([OH2+])CCCc1cccc(F)c1 |
| InChI | InChI=1S/C10H11FO2/c11-9-5-1-3-8(7-9)4-2-6-10(12)13/h1,3,5,7H,2,4,6H2,(H,12,13)/p+1 |
| InChIKey | SFUDEIQDDYJRKV-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 39.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|