C21H24F2N2O — CID 60541569
N-ethyl-N-[(3-fluorophenyl)methyl]-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide (PubChem CID 60541569) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 60541569 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(=O)N(CC)Cc1cccc(F)c1)Cc1ccccc1F |
| InChI | InChI=1S/C21H24F2N2O/c1-3-12-24(15-18-9-5-6-11-20(18)23)16-21(26)25(4-2)14-17-8-7-10-19(22)13-17/h3,5-11,13H,1,4,12,14-16H2,2H3 |
| InChIKey | OTQCSRZTBQZFBE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|