C15H18FN5OS — CID 60563776
N-ethyl-N-[(3-fluorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 60563776) has the molecular formula C15H18FN5OS and a molecular weight of 335.41 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 60563776 |
| Molecular Formula | C15H18FN5OS |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)N(CC)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H18FN5OS/c1-3-8-21-15(17-18-19-21)23-11-14(22)20(4-2)10-12-6-5-7-13(16)9-12/h3,5-7,9H,1,4,8,10-11H2,2H3 |
| InChIKey | AEUOMZHPRYZBJE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|