C13H14ClN5OS — CID 60563768
N-[(3-chlorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 60563768) has the molecular formula C13H14ClN5OS and a molecular weight of 323.81 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 60563768 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN5OS/c1-2-6-19-13(16-17-18-19)21-9-12(20)15-8-10-4-3-5-11(14)7-10/h2-5,7H,1,6,8-9H2,(H,15,20) |
| InChIKey | VQWOVSWUVDPNFE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|