C12H11Cl2N5OS — CID 9150641
N-(2,4-dichlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 9150641) has the molecular formula C12H11Cl2N5OS and a molecular weight of 344.23 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 9150641 |
| Molecular Formula | C12H11Cl2N5OS |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N5OS/c1-2-5-19-12(16-17-18-19)21-7-11(20)15-10-4-3-8(13)6-9(10)14/h2-4,6H,1,5,7H2,(H,15,20) |
| InChIKey | BZGGPBOZQHDTHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|