C12H12ClN5OS — CID 16648821
N-(4-chlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 16648821) has the molecular formula C12H12ClN5OS and a molecular weight of 309.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 16648821 |
| Molecular Formula | C12H12ClN5OS |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN5OS/c1-2-7-18-12(15-16-17-18)20-8-11(19)14-10-5-3-9(13)4-6-10/h2-6H,1,7-8H2,(H,14,19) |
| InChIKey | WVVAQRRMEVUDIS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|