C15H17N5O2S — CID 60564011
N-[4-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]phenyl]propanamide (PubChem CID 60564011) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[4-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]phenyl]propanamide.
| Compound Name | N-[4-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 60564011 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[4-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]phenyl]propanamide |
| SMILES | C=CCn1nnnc1SCC(=O)c1ccc(NC(=O)CC)cc1 |
| InChI | InChI=1S/C15H17N5O2S/c1-3-9-20-15(17-18-19-20)23-10-13(21)11-5-7-12(8-6-11)16-14(22)4-2/h3,5-8H,1,4,9-10H2,2H3,(H,16,22) |
| InChIKey | VBIZEQPBNZWSFR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|