C14H18N6O3S2 — CID 55996123
N-[4-methyl-3-(methylsulfamoyl)phenyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 55996123) has the molecular formula C14H18N6O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[4-methyl-3-(methylsulfamoyl)phenyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55996123 |
| Molecular Formula | C14H18N6O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)Nc1ccc(C)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C14H18N6O3S2/c1-4-7-20-14(17-18-19-20)24-9-13(21)16-11-6-5-10(2)12(8-11)25(22,23)15-3/h4-6,8,15H,1,7,9H2,2-3H3,(H,16,21) |
| InChIKey | BJRFAZFMVCXLAA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|