C18H17ClFN5OS — CID 8860215
2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 8860215) has the molecular formula C18H17ClFN5OS and a molecular weight of 405.89 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8860215 |
| Molecular Formula | C18H17ClFN5OS |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)CSc1nnnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClFN5OS/c1-2-24(11-13-5-3-7-15(20)9-13)17(26)12-27-18-21-22-23-25(18)16-8-4-6-14(19)10-16/h3-10H,2,11-12H2,1H3 |
| InChIKey | SUFQCQFGGASKHI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |