C17H16ClN5OS2 — CID 8860506
2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 8860506) has the molecular formula C17H16ClN5OS2 and a molecular weight of 405.94 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8860506 |
| Molecular Formula | C17H16ClN5OS2 |
| Molecular Weight | 405.94 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CSc1nnnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClN5OS2/c1-2-8-22(11-15-7-4-9-25-15)16(24)12-26-17-19-20-21-23(17)14-6-3-5-13(18)10-14/h2-7,9-10H,1,8,11-12H2 |
| InChIKey | JEGOGFXASJXDGK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|