C19H21N5O2S2 — CID 8682824
2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 8682824) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8682824 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CSc1nnnn1-c1cc(C)ccc1OC |
| InChI | InChI=1S/C19H21N5O2S2/c1-4-9-23(12-15-6-5-10-27-15)18(25)13-28-19-20-21-22-24(19)16-11-14(2)7-8-17(16)26-3/h4-8,10-11H,1,9,12-13H2,2-3H3 |
| InChIKey | XWPLIGCPANQLND-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|