C16H20BrNO3 — CID 79422617
ethyl 2-[3-(3-bromophenyl)propanoyl-prop-2-enylamino]acetate (PubChem CID 79422617) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is ethyl 2-[3-(3-bromophenyl)propanoyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[3-(3-bromophenyl)propanoyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 79422617 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | ethyl 2-[3-(3-bromophenyl)propanoyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)C(=O)CCc1cccc(Br)c1 |
| InChI | InChI=1S/C16H20BrNO3/c1-3-10-18(12-16(20)21-4-2)15(19)9-8-13-6-5-7-14(17)11-13/h3,5-7,11H,1,4,8-10,12H2,2H3 |
| InChIKey | SZNIAEDBRHPMLZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|