C19H27ClN4O6 — CID 154917685
2-(3-chlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid (PubChem CID 154917685) has the molecular formula C19H27ClN4O6 and a molecular weight of 442.90 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid.
| Compound Name | 2-(3-chlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid |
|---|---|
| PubChem CID | 154917685 |
| Molecular Formula | C19H27ClN4O6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)propanamide;formic acid |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)N(CCN(C)C)Cc1cnc[nH]1.O=CO.O=CO |
| InChI | InChI=1S/C17H23ClN4O2.2CH2O2/c1-13(24-16-6-4-5-14(18)9-16)17(23)22(8-7-21(2)3)11-15-10-19-12-20-15;2*2-1-3/h4-6,9-10,12-13H,7-8,11H2,1-3H3,(H,19,20);2*1H,(H,2,3) |
| InChIKey | HSPXOSUQCZJTAA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 136.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|