C16H28N4O — CID 135106056
2-cyclohexyl-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)acetamide (PubChem CID 135106056) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)acetamide.
| Compound Name | 2-cyclohexyl-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 135106056 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 2-cyclohexyl-N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)acetamide |
| SMILES | CN(C)CCN(Cc1cnc[nH]1)C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C16H28N4O/c1-19(2)8-9-20(12-15-11-17-13-18-15)16(21)10-14-6-4-3-5-7-14/h11,13-14H,3-10,12H2,1-2H3,(H,17,18) |
| InChIKey | YDHGZQQCAJBSKL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |