C12H21N3O — CID 176952178
ethane;N-(1H-imidazol-5-ylmethyl)-N-methylcyclobutanecarboxamide (PubChem CID 176952178) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;N-(1H-imidazol-5-ylmethyl)-N-methylcyclobutanecarboxamide.
| Compound Name | ethane;N-(1H-imidazol-5-ylmethyl)-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 176952178 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | ethane;N-(1H-imidazol-5-ylmethyl)-N-methylcyclobutanecarboxamide |
| SMILES | CC.CN(Cc1cnc[nH]1)C(=O)C1CCC1 |
| InChI | InChI=1S/C10H15N3O.C2H6/c1-13(6-9-5-11-7-12-9)10(14)8-3-2-4-8;1-2/h5,7-8H,2-4,6H2,1H3,(H,11,12);1-2H3 |
| InChIKey | BEBQJCKYPQPHME-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |