C12H18N2 — CID 59976346
5-[[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-1H-imidazole (PubChem CID 59976346) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-1H-imidazole.
| Compound Name | 5-[[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-1H-imidazole |
|---|---|
| PubChem CID | 59976346 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-[[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-1H-imidazole |
| SMILES | c1ncc(CC2C[C@H]3CCC[C@H]3C2)[nH]1 |
| InChI | InChI=1S/C12H18N2/c1-2-10-4-9(5-11(10)3-1)6-12-7-13-8-14-12/h7-11H,1-6H2,(H,13,14)/t9?,10-,11+ |
| InChIKey | VLGBWXVMMYTRCE-FGWVZKOKSA-N |
| XLogP | 2.78 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |