C11H16N2 — CID 20711765
5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole (PubChem CID 20711765) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole.
| Compound Name | 5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 20711765 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole |
| SMILES | CC1=CCC(Cc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C11H16N2/c1-9-2-4-10(5-3-9)6-11-7-12-8-13-11/h2,7-8,10H,3-6H2,1H3,(H,12,13) |
| InChIKey | CGSFVXKRNLQAPH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|