C14H25N3O2S — CID 91297795
5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole;N-methyl-N-methylsulfanylperoxymethanamine (PubChem CID 91297795) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole;N-methyl-N-methylsulfanylperoxymethanamine.
| Compound Name | 5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole;N-methyl-N-methylsulfanylperoxymethanamine |
|---|---|
| PubChem CID | 91297795 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 5-[(4-methylcyclohex-3-en-1-yl)methyl]-1H-imidazole;N-methyl-N-methylsulfanylperoxymethanamine |
| SMILES | CC1=CCC(Cc2cnc[nH]2)CC1.CSOON(C)C |
| InChI | InChI=1S/C11H16N2.C3H9NO2S/c1-9-2-4-10(5-3-9)6-11-7-12-8-13-11;1-4(2)5-6-7-3/h2,7-8,10H,3-6H2,1H3,(H,12,13);1-3H3 |
| InChIKey | OCCXLVDTQOUXTA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|