C10H18BN3O — CID 59880709
[(3R)-3-(1H-imidazol-5-ylmethyl)piperidin-1-yl]-methylborinic acid (PubChem CID 59880709) has the molecular formula C10H18BN3O and a molecular weight of 207.09 g/mol. Its IUPAC name is [(3R)-3-(1H-imidazol-5-ylmethyl)piperidin-1-yl]-methylborinic acid.
| Compound Name | [(3R)-3-(1H-imidazol-5-ylmethyl)piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59880709 |
| Molecular Formula | C10H18BN3O |
| Molecular Weight | 207.09 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | [(3R)-3-(1H-imidazol-5-ylmethyl)piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC[C@H](Cc2cnc[nH]2)C1 |
| InChI | InChI=1S/C10H18BN3O/c1-11(15)14-4-2-3-9(7-14)5-10-6-12-8-13-10/h6,8-9,15H,2-5,7H2,1H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | HABNCINVAQGVDS-SECBINFHSA-N |
| XLogP | 0.77 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|