C17H23ClN4O2 — CID 135092811
3-chloro-N-[2-(dimethylamino)ethyl]-4-ethoxy-N-(1H-imidazol-5-ylmethyl)benzamide (PubChem CID 135092811) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 3-chloro-N-[2-(dimethylamino)ethyl]-4-ethoxy-N-(1H-imidazol-5-ylmethyl)benzamide.
| Compound Name | 3-chloro-N-[2-(dimethylamino)ethyl]-4-ethoxy-N-(1H-imidazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 135092811 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-chloro-N-[2-(dimethylamino)ethyl]-4-ethoxy-N-(1H-imidazol-5-ylmethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(CCN(C)C)Cc2cnc[nH]2)cc1Cl |
| InChI | InChI=1S/C17H23ClN4O2/c1-4-24-16-6-5-13(9-15(16)18)17(23)22(8-7-21(2)3)11-14-10-19-12-20-14/h5-6,9-10,12H,4,7-8,11H2,1-3H3,(H,19,20) |
| InChIKey | OHSYJEWNTDALBL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |