C23H31N5O5 — CID 171321506
N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;formic acid (PubChem CID 171321506) has the molecular formula C23H31N5O5 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;formic acid.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 171321506 |
| Molecular Formula | C23H31N5O5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(1H-imidazol-5-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide;formic acid |
| SMILES | CN(C)CCN(Cc1cnc[nH]1)C(=O)c1ccc2[nH]c3c(c2c1)CCCC3.O=CO.O=CO |
| InChI | InChI=1S/C21H27N5O.2CH2O2/c1-25(2)9-10-26(13-16-12-22-14-23-16)21(27)15-7-8-20-18(11-15)17-5-3-4-6-19(17)24-20;2*2-1-3/h7-8,11-12,14,24H,3-6,9-10,13H2,1-2H3,(H,22,23);2*1H,(H,2,3) |
| InChIKey | JAKKESHMJGUEPB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|