C17H26ClNO2 — CID 897565
(2R)-2-(3-chlorophenoxy)-N,N-bis(2-methylpropyl)propanamide (PubChem CID 897565) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N,N-bis(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N,N-bis(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 897565 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N,N-bis(2-methylpropyl)propanamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)[C@@H](C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H26ClNO2/c1-12(2)10-19(11-13(3)4)17(20)14(5)21-16-8-6-7-15(18)9-16/h6-9,12-14H,10-11H2,1-5H3/t14-/m1/s1 |
| InChIKey | AWFUGAHRKMESEB-CQSZACIVSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |