C15H22ClNO4S — CID 96533228
(2R)-2-(3-chlorophenoxy)-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylpropanamide (PubChem CID 96533228) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylpropanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 96533228 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylpropanamide |
| SMILES | CCS(=O)(=O)C[C@H](C)N(C)C(=O)[C@@H](C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO4S/c1-5-22(19,20)10-11(2)17(4)15(18)12(3)21-14-8-6-7-13(16)9-14/h6-9,11-12H,5,10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | RPZKLBQRFCSSMJ-NWDGAFQWSA-N |
| XLogP | 2.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |