C13H16ClNO2 — CID 1489413
(E,4R)-4-(3-chlorophenoxy)-1-(dimethylamino)pent-1-en-3-one (PubChem CID 1489413) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is (E,4R)-4-(3-chlorophenoxy)-1-(dimethylamino)pent-1-en-3-one.
| Compound Name | (E,4R)-4-(3-chlorophenoxy)-1-(dimethylamino)pent-1-en-3-one |
|---|---|
| PubChem CID | 1489413 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (E,4R)-4-(3-chlorophenoxy)-1-(dimethylamino)pent-1-en-3-one |
| SMILES | C[C@@H](Oc1cccc(Cl)c1)C(=O)/C=C/N(C)C |
| InChI | InChI=1S/C13H16ClNO2/c1-10(13(16)7-8-15(2)3)17-12-6-4-5-11(14)9-12/h4-10H,1-3H3/b8-7+/t10-/m1/s1 |
| InChIKey | IUCFDMWFOHWDFV-QROSGCPLSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|