C14H16FNO5 — CID 54689319
(Z)-4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2-hydroxy-4-oxobut-2-enoic acid (PubChem CID 54689319) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is (Z)-4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54689319 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (Z)-4-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-2-hydroxy-4-oxobut-2-enoic acid |
| SMILES | COCCN(Cc1ccc(F)cc1)C(=O)/C=C(\O)C(=O)O |
| InChI | InChI=1S/C14H16FNO5/c1-21-7-6-16(13(18)8-12(17)14(19)20)9-10-2-4-11(15)5-3-10/h2-5,8,17H,6-7,9H2,1H3,(H,19,20)/b12-8- |
| InChIKey | ZYPMVLHHOLXRCY-WQLSENKSSA-N |
| XLogP | 1.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|