C17H20FNO7 — CID 72516187
4-[(4-fluorophenyl)methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]amino]-2-hydroxy-4-oxobut-2-enoic acid (PubChem CID 72516187) has the molecular formula C17H20FNO7 and a molecular weight of 369.35 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]amino]-2-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[(4-fluorophenyl)methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]amino]-2-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 72516187 |
| Molecular Formula | C17H20FNO7 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]amino]-2-hydroxy-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)CON(Cc1ccc(F)cc1)C(=O)C=C(O)C(=O)O |
| InChI | InChI=1S/C17H20FNO7/c1-17(2,3)26-15(22)10-25-19(14(21)8-13(20)16(23)24)9-11-4-6-12(18)7-5-11/h4-8,20H,9-10H2,1-3H3,(H,23,24) |
| InChIKey | CGBZRIDHBXJWOX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|